C21H34N4O4 — CID 86819826
6-cyclopropyl-2-N,4-N-bis[3-(oxolan-3-yloxy)propyl]pyrimidine-2,4-diamine (PubChem CID 86819826) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-cyclopropyl-2-N,4-N-bis[3-(oxolan-3-yloxy)propyl]pyrimidine-2,4-diamine.
| Compound Name | 6-cyclopropyl-2-N,4-N-bis[3-(oxolan-3-yloxy)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86819826 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 6-cyclopropyl-2-N,4-N-bis[3-(oxolan-3-yloxy)propyl]pyrimidine-2,4-diamine |
| SMILES | c1c(NCCCOC2CCOC2)nc(NCCCOC2CCOC2)nc1C1CC1 |
| InChI | InChI=1S/C21H34N4O4/c1(9-28-17-5-11-26-14-17)7-22-20-13-19(16-3-4-16)24-21(25-20)23-8-2-10-29-18-6-12-27-15-18/h13,16-18H,1-12,14-15H2,(H2,22,23,24,25) |
| InChIKey | XMKUAWVQXIKNBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|