About 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione
3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 86820016) has the molecular formula C13H8Cl2N2O2S
and a molecular weight of 327.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione |
| PubChem CID | 86820016 |
| Molecular Formula | C13H8Cl2N2O2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccsc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O2S/c14-9-2-1-8(5-10(9)15)17-12(18)11(16-13(17)19)7-3-4-20-6-7/h1-6,11H,(H,16,19) |
| InChIKey | IVLZTWSLLWZINC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione?
The IUPAC name of 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione (CID 86820016) is 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione?
The canonical SMILES for 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione is O=C1NC(c2ccsc2)C(=O)N1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione?
The InChIKey is IVLZTWSLLWZINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O2S/c14-9-2-1-8(5-10(9)15)17-12(18)11(16-13(17)19)7-3-4-20-6-7/h1-6,11H,(H,16,19).
What are the key properties of 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione?
3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione has a molecular weight of 327.19 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-5-thiophen-3-ylimidazolidine-2,4-dione is sourced from PubChem (CID 86820016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).