C15H22N2O — CID 86820387
(5aS,9aS)-1-benzyl-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine (PubChem CID 86820387) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (5aS,9aS)-1-benzyl-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine.
| Compound Name | (5aS,9aS)-1-benzyl-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine |
|---|---|
| PubChem CID | 86820387 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (5aS,9aS)-1-benzyl-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine |
| SMILES | c1ccc(CN2CCOC[C@H]3CCNC[C@H]32)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-2-4-13(5-3-1)11-17-8-9-18-12-14-6-7-16-10-15(14)17/h1-5,14-16H,6-12H2/t14-,15-/m1/s1 |
| InChIKey | VZTGACHYTPOBRI-HUUCEWRRSA-N |
| XLogP | 1.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |