About morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone
morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone (PubChem CID 86820399) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone |
| PubChem CID | 86820399 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone |
| SMILES | O=C([C@@H]1C[C@H](Oc2cccnc2)CN1)N1CCOCC1 |
| InChI | InChI=1S/C14H19N3O3/c18-14(17-4-6-19-7-5-17)13-8-12(10-16-13)20-11-2-1-3-15-9-11/h1-3,9,12-13,16H,4-8,10H2/t12-,13-/m0/s1 |
| InChIKey | DCLLFJDKMQJELW-STQMWFEESA-N |
| XLogP | 0.05 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone?
The IUPAC name of morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone (CID 86820399) is morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone.
What is the SMILES notation for morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone?
The canonical SMILES for morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone is O=C([C@@H]1C[C@H](Oc2cccnc2)CN1)N1CCOCC1.
What is the InChIKey of morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone?
The InChIKey is DCLLFJDKMQJELW-STQMWFEESA-N. The full InChI is InChI=1S/C14H19N3O3/c18-14(17-4-6-19-7-5-17)13-8-12(10-16-13)20-11-2-1-3-15-9-11/h1-3,9,12-13,16H,4-8,10H2/t12-,13-/m0/s1.
What are the key properties of morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone?
morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone has a molecular weight of 277.32 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[(2S,4S)-4-pyridin-3-yloxypyrrolidin-2-yl]methanone is sourced from PubChem (CID 86820399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).