C10H14N2O — CID 86820429
2-ethoxy-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 86820429) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-ethoxy-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | 2-ethoxy-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 86820429 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-ethoxy-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | CCOc1ccc2c(n1)CCNC2 |
| InChI | InChI=1S/C10H14N2O/c1-2-13-10-4-3-8-7-11-6-5-9(8)12-10/h3-4,11H,2,5-7H2,1H3 |
| InChIKey | NRHTXQFKGCRRHR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |