C11H16N2O2 — CID 86820430
2-(2-methoxyethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 86820430) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | 2-(2-methoxyethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 86820430 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(2-methoxyethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | COCCOc1ccc2c(n1)CCNC2 |
| InChI | InChI=1S/C11H16N2O2/c1-14-6-7-15-11-3-2-9-8-12-5-4-10(9)13-11/h2-3,12H,4-8H2,1H3 |
| InChIKey | RBQYARIFIKKWIH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|