About 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid
2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid (PubChem CID 86820453) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid |
| PubChem CID | 86820453 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid |
| SMILES | CN1C(=O)c2cccn2CC1C(=O)O |
| InChI | InChI=1S/C9H10N2O3/c1-10-7(9(13)14)5-11-4-2-3-6(11)8(10)12/h2-4,7H,5H2,1H3,(H,13,14) |
| InChIKey | DJVNLVUZCLJWGB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid?
The IUPAC name of 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid (CID 86820453) is 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid.
What is the SMILES notation for 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid?
The canonical SMILES for 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid is CN1C(=O)c2cccn2CC1C(=O)O.
What is the InChIKey of 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid?
The InChIKey is DJVNLVUZCLJWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-10-7(9(13)14)5-11-4-2-3-6(11)8(10)12/h2-4,7H,5H2,1H3,(H,13,14).
What are the key properties of 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid?
2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazine-3-carboxylic acid is sourced from PubChem (CID 86820453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).