C12H9IN2S — CID 868205
6-(4-iodophenyl)-2-methylimidazo[2,1-b][1,3]thiazole (PubChem CID 868205) has the molecular formula C12H9IN2S and a molecular weight of 340.19 g/mol. Its IUPAC name is 6-(4-iodophenyl)-2-methylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(4-iodophenyl)-2-methylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 868205 |
| Molecular Formula | C12H9IN2S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 6-(4-iodophenyl)-2-methylimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cn2cc(-c3ccc(I)cc3)nc2s1 |
| InChI | InChI=1S/C12H9IN2S/c1-8-6-15-7-11(14-12(15)16-8)9-2-4-10(13)5-3-9/h2-7H,1H3 |
| InChIKey | JEWGDXRBUBAMFY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|