C15H18FN3O2 — CID 86820611
3-[2-(4-fluorophenoxy)ethyl]-5-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 86820611) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethyl]-5-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 3-[2-(4-fluorophenoxy)ethyl]-5-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 86820611 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethyl]-5-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | Fc1ccc(OCCc2noc(C3CCCNC3)n2)cc1 |
| InChI | InChI=1S/C15H18FN3O2/c16-12-3-5-13(6-4-12)20-9-7-14-18-15(21-19-14)11-2-1-8-17-10-11/h3-6,11,17H,1-2,7-10H2 |
| InChIKey | OIXKOXSFFCGGLE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |