C23H30N2OS — CID 8682410
N-(1-benzylpiperidin-4-yl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide (PubChem CID 8682410) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 8682410 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide |
| SMILES | Cc1cc(C)c(SCC(=O)NC2CCN(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H30N2OS/c1-17-13-18(2)23(19(3)14-17)27-16-22(26)24-21-9-11-25(12-10-21)15-20-7-5-4-6-8-20/h4-8,13-14,21H,9-12,15-16H2,1-3H3,(H,24,26) |
| InChIKey | XMAJIOJGVDNPLR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |