C18H18FN5O2S — CID 8682452
N-[(2-fluorophenyl)methyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-methylacetamide (PubChem CID 8682452) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 8682452 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-methylacetamide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)N(C)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H18FN5O2S/c1-23(11-13-5-3-4-6-16(13)19)17(25)12-27-18-20-21-22-24(18)14-7-9-15(26-2)10-8-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | QHNDAWUUAREFLB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |