C16H21N3O3S — CID 86825843
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide (PubChem CID 86825843) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 86825843 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide |
| SMILES | Cc1ncc(CNC(=O)CCN2C(=O)C3CCCCC3C2=O)s1 |
| InChI | InChI=1S/C16H21N3O3S/c1-10-17-8-11(23-10)9-18-14(20)6-7-19-15(21)12-4-2-3-5-13(12)16(19)22/h8,12-13H,2-7,9H2,1H3,(H,18,20) |
| InChIKey | LEIIHWLCOFIDFC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|