About 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate
2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate (PubChem CID 86827232) has the molecular formula C18H25N3O4S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate |
| PubChem CID | 86827232 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate |
| SMILES | Cc1cc(C)n(CCOC(=O)c2cc(C)c(C)c(S(=O)(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C18H25N3O4S/c1-12-9-16(11-17(15(12)4)26(23,24)20(5)6)18(22)25-8-7-21-14(3)10-13(2)19-21/h9-11H,7-8H2,1-6H3 |
| InChIKey | CDBCDIKPQJXPQF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate (CID 86827232) is 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate is Cc1cc(C)n(CCOC(=O)c2cc(C)c(C)c(S(=O)(=O)N(C)C)c2)n1.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate?
The InChIKey is CDBCDIKPQJXPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4S/c1-12-9-16(11-17(15(12)4)26(23,24)20(5)6)18(22)25-8-7-21-14(3)10-13(2)19-21/h9-11H,7-8H2,1-6H3.
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate?
2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate has a molecular weight of 379.48 g/mol, XLogP of 2.22, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate is sourced from PubChem (CID 86827232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).