C16H15FN4O3S2 — CID 8682823
1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(4-nitrophenyl)thiourea (PubChem CID 8682823) has the molecular formula C16H15FN4O3S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8682823 |
| Molecular Formula | C16H15FN4O3S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(4-nitrophenyl)thiourea |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15FN4O3S2/c17-11-1-7-14(8-2-11)26-10-9-15(22)19-20-16(25)18-12-3-5-13(6-4-12)21(23)24/h1-8H,9-10H2,(H,19,22)(H2,18,20,25) |
| InChIKey | IAUDQHAGSCLOMY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|