C23H23F2N5O2 — CID 86829174
N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 86829174) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86829174 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Nc1cc(CCCNC(=O)C2CCN(c3cc(F)cc(F)c3)C2=O)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H23F2N5O2/c24-15-11-16(25)13-19(12-15)29-10-8-20(23(29)32)22(31)27-9-4-5-17-14-21(26)30(28-17)18-6-2-1-3-7-18/h1-3,6-7,11-14,20H,4-5,8-10,26H2,(H,27,31) |
| InChIKey | WPAIWXIRQQCELO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|