C16H30F3N3O2 — CID 86831252
1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 86831252) has the molecular formula C16H30F3N3O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 86831252 |
| Molecular Formula | C16H30F3N3O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | CC1CC(C)CN(C(C)(C)CNC(=O)NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C16H30F3N3O2/c1-12-7-13(2)9-22(8-12)15(3,4)10-21-14(23)20-5-6-24-11-16(17,18)19/h12-13H,5-11H2,1-4H3,(H2,20,21,23) |
| InChIKey | RHTCEXYEFSMRMD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|