C11H16F3NO — CID 86833481
2-cyclopent-2-en-1-yl-N-methyl-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 86833481) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-methyl-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-methyl-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 86833481 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-methyl-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | CN(CCC(F)(F)F)C(=O)CC1C=CCC1 |
| InChI | InChI=1S/C11H16F3NO/c1-15(7-6-11(12,13)14)10(16)8-9-4-2-3-5-9/h2,4,9H,3,5-8H2,1H3 |
| InChIKey | RAGMOFVYOSXZFT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|