C20H31N3OS — CID 8683516
1-(2,3-dimethylphenyl)-3-[(1-morpholin-4-ylcyclohexyl)methyl]thiourea (PubChem CID 8683516) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(1-morpholin-4-ylcyclohexyl)methyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(1-morpholin-4-ylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 8683516 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(1-morpholin-4-ylcyclohexyl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)NCC2(N3CCOCC3)CCCCC2)c1C |
| InChI | InChI=1S/C20H31N3OS/c1-16-7-6-8-18(17(16)2)22-19(25)21-15-20(9-4-3-5-10-20)23-11-13-24-14-12-23/h6-8H,3-5,9-15H2,1-2H3,(H2,21,22,25) |
| InChIKey | HEHPJIUHRHZWHD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|