C20H25N5O2S — CID 86835259
4-[[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N,N-bis(prop-2-enyl)benzamide (PubChem CID 86835259) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-[[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 4-[[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 86835259 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(NC(=O)CSc2nncn2C(C)C)cc1 |
| InChI | InChI=1S/C20H25N5O2S/c1-5-11-24(12-6-2)19(27)16-7-9-17(10-8-16)22-18(26)13-28-20-23-21-14-25(20)15(3)4/h5-10,14-15H,1-2,11-13H2,3-4H3,(H,22,26) |
| InChIKey | SXVRDTBXAYFKAW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|