C17H16N4O3 — CID 86835841
1-[[4-[(2-cyanophenyl)methoxy]benzoyl]amino]-3-methylurea (PubChem CID 86835841) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[[4-[(2-cyanophenyl)methoxy]benzoyl]amino]-3-methylurea.
| Compound Name | 1-[[4-[(2-cyanophenyl)methoxy]benzoyl]amino]-3-methylurea |
|---|---|
| PubChem CID | 86835841 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[[4-[(2-cyanophenyl)methoxy]benzoyl]amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)c1ccc(OCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-19-17(23)21-20-16(22)12-6-8-15(9-7-12)24-11-14-5-3-2-4-13(14)10-18/h2-9H,11H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | BSQFBYXYGCXYFS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|