C16H17F2N3O2S — CID 86836277
2,4-difluoro-N-[4-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutyl]benzamide (PubChem CID 86836277) has the molecular formula C16H17F2N3O2S and a molecular weight of 353.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 86836277 |
| Molecular Formula | C16H17F2N3O2S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2,4-difluoro-N-[4-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutyl]benzamide |
| SMILES | Cc1ncc(CNC(=O)CCCNC(=O)c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C16H17F2N3O2S/c1-10-20-8-12(24-10)9-21-15(22)3-2-6-19-16(23)13-5-4-11(17)7-14(13)18/h4-5,7-8H,2-3,6,9H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | AJOURPBPYMUYEO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|