C21H29N3O4 — CID 86837322
propan-2-yl 3-[[4-(5-methoxy-1H-indol-3-yl)piperidine-1-carbonyl]amino]propanoate (PubChem CID 86837322) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is propan-2-yl 3-[[4-(5-methoxy-1H-indol-3-yl)piperidine-1-carbonyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[4-(5-methoxy-1H-indol-3-yl)piperidine-1-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 86837322 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | propan-2-yl 3-[[4-(5-methoxy-1H-indol-3-yl)piperidine-1-carbonyl]amino]propanoate |
| SMILES | COc1ccc2[nH]cc(C3CCN(C(=O)NCCC(=O)OC(C)C)CC3)c2c1 |
| InChI | InChI=1S/C21H29N3O4/c1-14(2)28-20(25)6-9-22-21(26)24-10-7-15(8-11-24)18-13-23-19-5-4-16(27-3)12-17(18)19/h4-5,12-15,23H,6-11H2,1-3H3,(H,22,26) |
| InChIKey | VXVKJCQUBSIKPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |