C17H23FN2O — CID 86838302
1-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(2-methylcyclohexyl)urea (PubChem CID 86838302) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(2-methylcyclohexyl)urea.
| Compound Name | 1-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(2-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 86838302 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(2-methylcyclohexyl)urea |
| SMILES | CC1CCCCC1NC(=O)NC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C17H23FN2O/c1-11-5-2-3-8-15(11)19-17(21)20-16-10-9-12-13(16)6-4-7-14(12)18/h4,6-7,11,15-16H,2-3,5,8-10H2,1H3,(H2,19,20,21) |
| InChIKey | NOOVNNMTXWXLRF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |