C16H20N2O4S — CID 86839237
ethyl 1-[(3-cyanophenyl)methylsulfonylamino]cyclopentane-1-carboxylate (PubChem CID 86839237) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 1-[(3-cyanophenyl)methylsulfonylamino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-[(3-cyanophenyl)methylsulfonylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86839237 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl 1-[(3-cyanophenyl)methylsulfonylamino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NS(=O)(=O)Cc2cccc(C#N)c2)CCCC1 |
| InChI | InChI=1S/C16H20N2O4S/c1-2-22-15(19)16(8-3-4-9-16)18-23(20,21)12-14-7-5-6-13(10-14)11-17/h5-7,10,18H,2-4,8-9,12H2,1H3 |
| InChIKey | OECYAVQELBCEDI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |