C21H21N5O3 — CID 86840062
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 86840062) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 86840062 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3c(C)nn4cccnc34)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H21N5O3/c1-3-21(10-9-16(27)24-20(21)29)14-5-7-15(8-6-14)23-19(28)17-13(2)25-26-12-4-11-22-18(17)26/h4-8,11-12H,3,9-10H2,1-2H3,(H,23,28)(H,24,27,29) |
| InChIKey | OTXRDPCMCXXFIM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|