About 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol
1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 86842881) has the molecular formula C12H18F3NO2S
and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| PubChem CID | 86842881 |
| Molecular Formula | C12H18F3NO2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CN(CCC(F)(F)F)CC(O)COCc1cccs1 |
| InChI | InChI=1S/C12H18F3NO2S/c1-16(5-4-12(13,14)15)7-10(17)8-18-9-11-3-2-6-19-11/h2-3,6,10,17H,4-5,7-9H2,1H3 |
| InChIKey | USGWTYDZINJTKI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol?
The IUPAC name of 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol (CID 86842881) is 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
What is the SMILES notation for 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol?
The canonical SMILES for 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol is CN(CCC(F)(F)F)CC(O)COCc1cccs1.
What is the InChIKey of 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol?
The InChIKey is USGWTYDZINJTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO2S/c1-16(5-4-12(13,14)15)7-10(17)8-18-9-11-3-2-6-19-11/h2-3,6,10,17H,4-5,7-9H2,1H3.
What are the key properties of 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol?
1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol has a molecular weight of 297.34 g/mol, XLogP of 2.51, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol is sourced from PubChem (CID 86842881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).