About (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate
(2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 86844927) has the molecular formula C15H15NO2S
and a molecular weight of 273.36 g/mol. Its IUPAC name is (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 86844927 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CC1CC1COC(=O)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H15NO2S/c1-10-7-12(10)9-18-15(17)13-8-16-14(19-13)11-5-3-2-4-6-11/h2-6,8,10,12H,7,9H2,1H3 |
| InChIKey | CAXQYAJDEQZBFF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate (CID 86844927) is (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate is CC1CC1COC(=O)c1cnc(-c2ccccc2)s1.
What is the InChIKey of (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is CAXQYAJDEQZBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c1-10-7-12(10)9-18-15(17)13-8-16-14(19-13)11-5-3-2-4-6-11/h2-6,8,10,12H,7,9H2,1H3.
What are the key properties of (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate?
(2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 273.36 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopropyl)methyl 2-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 86844927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).