C15H19N3O3S — CID 86846605
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 86846605) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 86846605 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | Cc1ncc(CNC(=O)CN2C(=O)C3CCCCC3C2=O)s1 |
| InChI | InChI=1S/C15H19N3O3S/c1-9-16-6-10(22-9)7-17-13(19)8-18-14(20)11-4-2-3-5-12(11)15(18)21/h6,11-12H,2-5,7-8H2,1H3,(H,17,19) |
| InChIKey | FUQGUAUYPFTRKG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|