C14H17F2NO3 — CID 86846916
2-(cyclopropylmethoxy)-N-[2-(difluoromethoxy)phenyl]propanamide (PubChem CID 86846916) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N-[2-(difluoromethoxy)phenyl]propanamide.
| Compound Name | 2-(cyclopropylmethoxy)-N-[2-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 86846916 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N-[2-(difluoromethoxy)phenyl]propanamide |
| SMILES | CC(OCC1CC1)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H17F2NO3/c1-9(19-8-10-6-7-10)13(18)17-11-4-2-3-5-12(11)20-14(15)16/h2-5,9-10,14H,6-8H2,1H3,(H,17,18) |
| InChIKey | KKSZNOJFRKEWQR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |