C21H28N4O3 — CID 86847072
3-(2-methylbenzimidazol-1-yl)propyl 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 86847072) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(2-methylbenzimidazol-1-yl)propyl 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | 3-(2-methylbenzimidazol-1-yl)propyl 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 86847072 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-(2-methylbenzimidazol-1-yl)propyl 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | Cc1nc2ccccc2n1CCCOC(=O)CCCc1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C21H28N4O3/c1-15-22-16-9-5-6-10-17(16)25(15)13-8-14-27-19(26)12-7-11-18-23-20(24-28-18)21(2,3)4/h5-6,9-10H,7-8,11-14H2,1-4H3 |
| InChIKey | RZLZMHXECROPNK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|