C23H28N2O4S — CID 86847467
1-(2-methyl-1H-indol-3-yl)-2-[methyl-[3-(4-methylsulfonylphenoxy)propyl]amino]propan-1-one (PubChem CID 86847467) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-[methyl-[3-(4-methylsulfonylphenoxy)propyl]amino]propan-1-one.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-[methyl-[3-(4-methylsulfonylphenoxy)propyl]amino]propan-1-one |
|---|---|
| PubChem CID | 86847467 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-[methyl-[3-(4-methylsulfonylphenoxy)propyl]amino]propan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)N(C)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-16-22(20-8-5-6-9-21(20)24-16)23(26)17(2)25(3)14-7-15-29-18-10-12-19(13-11-18)30(4,27)28/h5-6,8-13,17,24H,7,14-15H2,1-4H3 |
| InChIKey | LSDXYODKRVQYRR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|