C18H18N4O3S — CID 86848842
3-(ethylsulfamoyl)-N-(1-phenylpyrazol-4-yl)benzamide (PubChem CID 86848842) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-(1-phenylpyrazol-4-yl)benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-(1-phenylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 86848842 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-(1-phenylpyrazol-4-yl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)Nc2cnn(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C18H18N4O3S/c1-2-20-26(24,25)17-10-6-7-14(11-17)18(23)21-15-12-19-22(13-15)16-8-4-3-5-9-16/h3-13,20H,2H2,1H3,(H,21,23) |
| InChIKey | NTJKVQVSILGEGI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |