C11H11N3O2S2 — CID 86849784
N-(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)oxolane-3-carboxamide (PubChem CID 86849784) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)oxolane-3-carboxamide.
| Compound Name | N-(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 86849784 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)oxolane-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccsc2)s1)C1CCOC1 |
| InChI | InChI=1S/C11H11N3O2S2/c15-9(7-1-3-16-5-7)12-11-14-13-10(18-11)8-2-4-17-6-8/h2,4,6-7H,1,3,5H2,(H,12,14,15) |
| InChIKey | WMPFPFDMBJZFSF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |