C15H18ClN3O3S — CID 86851215
1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[(2-methyl-1,3-thiazol-5-yl)methyl]urea (PubChem CID 86851215) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[(2-methyl-1,3-thiazol-5-yl)methyl]urea.
| Compound Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[(2-methyl-1,3-thiazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 86851215 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[(2-methyl-1,3-thiazol-5-yl)methyl]urea |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)NCc1cnc(C)s1 |
| InChI | InChI=1S/C15H18ClN3O3S/c1-10-17-8-11(23-10)9-18-15(20)19-13-5-3-4-12(16)14(13)22-7-6-21-2/h3-5,8H,6-7,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | OFRMDQFTSDDVBA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|