C18H29N3O3S — CID 86851357
1-[3-(benzenesulfonyl)propyl]-3-(2-methyl-3-pyrrolidin-1-ylpropyl)urea (PubChem CID 86851357) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-(2-methyl-3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-(2-methyl-3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 86851357 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-(2-methyl-3-pyrrolidin-1-ylpropyl)urea |
| SMILES | CC(CNC(=O)NCCCS(=O)(=O)c1ccccc1)CN1CCCC1 |
| InChI | InChI=1S/C18H29N3O3S/c1-16(15-21-11-5-6-12-21)14-20-18(22)19-10-7-13-25(23,24)17-8-3-2-4-9-17/h2-4,8-9,16H,5-7,10-15H2,1H3,(H2,19,20,22) |
| InChIKey | MWFAYJJMIQFNOI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|