C18H17F2NO — CID 86851617
N-[(4-fluoro-3-methylphenyl)methyl]-2-(3-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 86851617) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-2-(3-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-(3-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86851617 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-(3-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(CNC(=O)C2CC2c2cccc(F)c2)ccc1F |
| InChI | InChI=1S/C18H17F2NO/c1-11-7-12(5-6-17(11)20)10-21-18(22)16-9-15(16)13-3-2-4-14(19)8-13/h2-8,15-16H,9-10H2,1H3,(H,21,22) |
| InChIKey | VQGRZJFXFBQMAI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |