C19H25ClN4O — CID 86858726
5-chloro-N-[3-[4-(dimethylamino)phenyl]propyl]-2-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 86858726) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is 5-chloro-N-[3-[4-(dimethylamino)phenyl]propyl]-2-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[3-[4-(dimethylamino)phenyl]propyl]-2-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 86858726 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-chloro-N-[3-[4-(dimethylamino)phenyl]propyl]-2-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)NCCCc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C19H25ClN4O/c1-13(2)18-22-12-16(20)17(23-18)19(25)21-11-5-6-14-7-9-15(10-8-14)24(3)4/h7-10,12-13H,5-6,11H2,1-4H3,(H,21,25) |
| InChIKey | QTUUYCABIJKCFY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|