C17H18F2N2O2 — CID 86861767
2-[benzyl(methyl)amino]-N-(3,5-difluoro-4-methoxyphenyl)acetamide (PubChem CID 86861767) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(3,5-difluoro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-(3,5-difluoro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86861767 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(3,5-difluoro-4-methoxyphenyl)acetamide |
| SMILES | COc1c(F)cc(NC(=O)CN(C)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C17H18F2N2O2/c1-21(10-12-6-4-3-5-7-12)11-16(22)20-13-8-14(18)17(23-2)15(19)9-13/h3-9H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | KCNIFZOHSZYJGS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |