About N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide
N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86861831) has the molecular formula C7H8F3N3O2
and a molecular weight of 223.15 g/mol. Its IUPAC name is N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
Molecular Properties
| Compound Name | N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| PubChem CID | 86861831 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H8F3N3O2/c8-7(9,10)4-15-3-6(14)12-5-1-2-11-13-5/h1-2H,3-4H2,(H2,11,12,13,14) |
| InChIKey | ULWSACLEYRNBDZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide?
The IUPAC name of N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide (CID 86861831) is N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
What is the SMILES notation for N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide?
The canonical SMILES for N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide is O=C(COCC(F)(F)F)Nc1ccn[nH]1.
What is the InChIKey of N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide?
The InChIKey is ULWSACLEYRNBDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O2/c8-7(9,10)4-15-3-6(14)12-5-1-2-11-13-5/h1-2H,3-4H2,(H2,11,12,13,14).
What are the key properties of N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide?
N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide has a molecular weight of 223.15 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrazol-5-yl)-2-(2,2,2-trifluoroethoxy)acetamide is sourced from PubChem (CID 86861831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).