C18H18N6O2S — CID 8686229
N-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide (PubChem CID 8686229) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is N-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | N-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 8686229 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CSc2nnnn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C18H18N6O2S/c1-12-5-3-4-6-15(12)24-18(21-22-23-24)27-11-16(25)20-14-9-7-13(8-10-14)17(26)19-2/h3-10H,11H2,1-2H3,(H,19,26)(H,20,25) |
| InChIKey | XTHRSOQXSNCYLR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |