C10H16ClN3O4S2 — CID 868627
4-amino-6-chloro-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-disulfonamide (PubChem CID 868627) has the molecular formula C10H16ClN3O4S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-amino-6-chloro-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-disulfonamide.
| Compound Name | 4-amino-6-chloro-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 868627 |
| Molecular Formula | C10H16ClN3O4S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-amino-6-chloro-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(S(=O)(=O)N(C)C)c(Cl)cc1N |
| InChI | InChI=1S/C10H16ClN3O4S2/c1-13(2)19(15,16)9-6-10(8(12)5-7(9)11)20(17,18)14(3)4/h5-6H,12H2,1-4H3 |
| InChIKey | DITLKVJIRDDLEG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|