C21H23FN2O3 — CID 86862975
3-[1-(2,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-prop-2-ynylurea (PubChem CID 86862975) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[1-(2,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-prop-2-ynylurea.
| Compound Name | 3-[1-(2,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 86862975 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[1-(2,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-prop-2-ynylurea |
| SMILES | C#CCN(Cc1ccc(F)cc1)C(=O)NC(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C21H23FN2O3/c1-5-12-24(14-16-6-8-17(22)9-7-16)21(25)23-15(2)19-11-10-18(26-3)13-20(19)27-4/h1,6-11,13,15H,12,14H2,2-4H3,(H,23,25) |
| InChIKey | UZYFQQUNACYZSR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|