C18H18N4O3 — CID 86864818
2-N-[3-(pyrrolidine-1-carbonyl)phenyl]pyridine-2,5-dicarboxamide (PubChem CID 86864818) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-N-[3-(pyrrolidine-1-carbonyl)phenyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-[3-(pyrrolidine-1-carbonyl)phenyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 86864818 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-N-[3-(pyrrolidine-1-carbonyl)phenyl]pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2cccc(C(=O)N3CCCC3)c2)nc1 |
| InChI | InChI=1S/C18H18N4O3/c19-16(23)13-6-7-15(20-11-13)17(24)21-14-5-3-4-12(10-14)18(25)22-8-1-2-9-22/h3-7,10-11H,1-2,8-9H2,(H2,19,23)(H,21,24) |
| InChIKey | IBXSEQJPODVMLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |