C21H23NO4S — CID 86868872
N-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-(2-ethoxyphenyl)propanamide (PubChem CID 86868872) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-(2-ethoxyphenyl)propanamide.
| Compound Name | N-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-(2-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 86868872 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-(2-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccccc1CCC(=O)NS(=O)(=O)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-26-20-10-6-5-8-17(20)12-14-21(23)22-27(24,25)19-13-11-16-7-3-4-9-18(16)15-19/h3-10,15H,2,11-14H2,1H3,(H,22,23) |
| InChIKey | VEDPIOOOWCNTHM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |