C13H12F3N3O2 — CID 86869419
5-(furan-2-yl)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide (PubChem CID 86869419) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86869419 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-(furan-2-yl)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide |
| SMILES | C=CCN(CC(F)(F)F)C(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-2-5-19(8-13(14,15)16)12(20)10-7-9(17-18-10)11-4-3-6-21-11/h2-4,6-7H,1,5,8H2,(H,17,18) |
| InChIKey | UZLSPSAEHNTEBV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|