C17H15BrN2O4 — CID 86876049
(4-methoxyphenyl)methyl 5-[(4-bromopyrazol-1-yl)methyl]furan-2-carboxylate (PubChem CID 86876049) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 5-[(4-bromopyrazol-1-yl)methyl]furan-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 5-[(4-bromopyrazol-1-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 86876049 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | (4-methoxyphenyl)methyl 5-[(4-bromopyrazol-1-yl)methyl]furan-2-carboxylate |
| SMILES | COc1ccc(COC(=O)c2ccc(Cn3cc(Br)cn3)o2)cc1 |
| InChI | InChI=1S/C17H15BrN2O4/c1-22-14-4-2-12(3-5-14)11-23-17(21)16-7-6-15(24-16)10-20-9-13(18)8-19-20/h2-9H,10-11H2,1H3 |
| InChIKey | FYHVZOCUKVWQKU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |