C26H29N3O3 — CID 86876337
(2-ethoxyphenyl)-[4-[1-(2-phenylethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 86876337) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (2-ethoxyphenyl)-[4-[1-(2-phenylethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (2-ethoxyphenyl)-[4-[1-(2-phenylethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86876337 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2-ethoxyphenyl)-[4-[1-(2-phenylethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1C(=O)N1CCN(C(=O)c2cccn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O3/c1-2-32-24-13-7-6-11-22(24)25(30)28-17-19-29(20-18-28)26(31)23-12-8-15-27(23)16-14-21-9-4-3-5-10-21/h3-13,15H,2,14,16-20H2,1H3 |
| InChIKey | YJNMUYXEDVAVSU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |