C20H22N2O3 — CID 86878702
N-[3-[ethyl(methyl)amino]phenyl]-7-methoxy-2H-chromene-3-carboxamide (PubChem CID 86878702) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[3-[ethyl(methyl)amino]phenyl]-7-methoxy-2H-chromene-3-carboxamide.
| Compound Name | N-[3-[ethyl(methyl)amino]phenyl]-7-methoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 86878702 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[3-[ethyl(methyl)amino]phenyl]-7-methoxy-2H-chromene-3-carboxamide |
| SMILES | CCN(C)c1cccc(NC(=O)C2=Cc3ccc(OC)cc3OC2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-22(2)17-7-5-6-16(11-17)21-20(23)15-10-14-8-9-18(24-3)12-19(14)25-13-15/h5-12H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | NSPAJDMNZXHJJA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |