C17H25NO4 — CID 86880419
ethyl 3-[2-hydroxy-3-(3-methylpyrrolidin-1-yl)propoxy]benzoate (PubChem CID 86880419) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl 3-[2-hydroxy-3-(3-methylpyrrolidin-1-yl)propoxy]benzoate.
| Compound Name | ethyl 3-[2-hydroxy-3-(3-methylpyrrolidin-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 86880419 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | ethyl 3-[2-hydroxy-3-(3-methylpyrrolidin-1-yl)propoxy]benzoate |
| SMILES | CCOC(=O)c1cccc(OCC(O)CN2CCC(C)C2)c1 |
| InChI | InChI=1S/C17H25NO4/c1-3-21-17(20)14-5-4-6-16(9-14)22-12-15(19)11-18-8-7-13(2)10-18/h4-6,9,13,15,19H,3,7-8,10-12H2,1-2H3 |
| InChIKey | YKMGKSHZWAZZPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |