C14H9F2IN4O — CID 86880713
N-(3,5-difluoro-4-iodophenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 86880713) has the molecular formula C14H9F2IN4O and a molecular weight of 414.15 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 86880713 |
| Molecular Formula | C14H9F2IN4O |
| Molecular Weight | 414.15 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | Cc1nnc2ccc(C(=O)Nc3cc(F)c(I)c(F)c3)cn12 |
| InChI | InChI=1S/C14H9F2IN4O/c1-7-19-20-12-3-2-8(6-21(7)12)14(22)18-9-4-10(15)13(17)11(16)5-9/h2-6H,1H3,(H,18,22) |
| InChIKey | BSVRBUSJYAUIBH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|